C22H18N2O5 — CID 136845916
methyl 4-hydroxy-3,5-bis[(2-hydroxyphenyl)iminomethyl]benzoate (PubChem CID 136845916) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is methyl 4-hydroxy-3,5-bis[(2-hydroxyphenyl)iminomethyl]benzoate.
| Compound Name | methyl 4-hydroxy-3,5-bis[(2-hydroxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 136845916 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl 4-hydroxy-3,5-bis[(2-hydroxyphenyl)iminomethyl]benzoate |
| SMILES | COC(=O)c1cc(/C=N/c2ccccc2O)c(O)c(/C=N/c2ccccc2O)c1 |
| InChI | InChI=1S/C22H18N2O5/c1-29-22(28)14-10-15(12-23-17-6-2-4-8-19(17)25)21(27)16(11-14)13-24-18-7-3-5-9-20(18)26/h2-13,25-27H,1H3/b23-12+,24-13+ |
| InChIKey | ZFBMANGJEULXPW-MPDMMBQKSA-N |
| XLogP | 4.09 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|