C17H14BrNO5 — CID 135595464
dimethyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate (PubChem CID 135595464) has the molecular formula C17H14BrNO5 and a molecular weight of 392.21 g/mol. Its IUPAC name is dimethyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135595464 |
| Molecular Formula | C17H14BrNO5 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | dimethyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=C/c2cc(Br)ccc2O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H14BrNO5/c1-23-16(21)10-5-11(17(22)24-2)8-14(7-10)19-9-12-6-13(18)3-4-15(12)20/h3-9,20H,1-2H3/b19-9+ |
| InChIKey | OASZPBORMLRBQF-DJKKODMXSA-N |
| XLogP | 3.48 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|