C19H19BrN2O4 — CID 135633379
methyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylbenzoate (PubChem CID 135633379) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is methyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 135633379 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | methyl 5-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(/N=C/c2cc(Br)ccc2O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H19BrN2O4/c1-25-19(24)16-11-15(3-4-17(16)22-6-8-26-9-7-22)21-12-13-10-14(20)2-5-18(13)23/h2-5,10-12,23H,6-9H2,1H3/b21-12+ |
| InChIKey | YTDSKSJLLDOXDD-CIAFOILYSA-N |
| XLogP | 3.53 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|