C20H23BrN2O4 — CID 2039329
methyl 5-[(5-bromo-2-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate (PubChem CID 2039329) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is methyl 5-[(5-bromo-2-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 5-[(5-bromo-2-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 2039329 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | methyl 5-[(5-bromo-2-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(NCc2cc(Br)ccc2OC)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-25-19-6-3-15(21)11-14(19)13-22-16-4-5-18(17(12-16)20(24)26-2)23-7-9-27-10-8-23/h3-6,11-12,22H,7-10,13H2,1-2H3 |
| InChIKey | LLUOLIVHQMUIGW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|