C12H17BrN2O2 — CID 83009516
N-[(5-bromo-2-methoxyphenyl)methyl]morpholin-4-amine (PubChem CID 83009516) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]morpholin-4-amine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]morpholin-4-amine |
|---|---|
| PubChem CID | 83009516 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]morpholin-4-amine |
| SMILES | COc1ccc(Br)cc1CNN1CCOCC1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-16-12-3-2-11(13)8-10(12)9-14-15-4-6-17-7-5-15/h2-3,8,14H,4-7,9H2,1H3 |
| InChIKey | UPFWRFQDBVGULH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |