C13H20N2O3 — CID 83011668
N-[(3,5-dimethoxyphenyl)methyl]morpholin-4-amine (PubChem CID 83011668) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]morpholin-4-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]morpholin-4-amine |
|---|---|
| PubChem CID | 83011668 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]morpholin-4-amine |
| SMILES | COc1cc(CNN2CCOCC2)cc(OC)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-16-12-7-11(8-13(9-12)17-2)10-14-15-3-5-18-6-4-15/h7-9,14H,3-6,10H2,1-2H3 |
| InChIKey | RSVFLWHSFCCGBK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |