C12H16Br2N2O2 — CID 83010027
N-[(3,5-dibromo-4-methoxyphenyl)methyl]morpholin-4-amine (PubChem CID 83010027) has the molecular formula C12H16Br2N2O2 and a molecular weight of 380.08 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methoxyphenyl)methyl]morpholin-4-amine.
| Compound Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]morpholin-4-amine |
|---|---|
| PubChem CID | 83010027 |
| Molecular Formula | C12H16Br2N2O2 |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]morpholin-4-amine |
| SMILES | COc1c(Br)cc(CNN2CCOCC2)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O2/c1-17-12-10(13)6-9(7-11(12)14)8-15-16-2-4-18-5-3-16/h6-7,15H,2-5,8H2,1H3 |
| InChIKey | CXWQWEQQHAPVIW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |