C14H19Br2NO3 — CID 78928832
4-[[(3,5-dibromo-4-methoxyphenyl)methylamino]methyl]oxan-4-ol (PubChem CID 78928832) has the molecular formula C14H19Br2NO3 and a molecular weight of 409.12 g/mol. Its IUPAC name is 4-[[(3,5-dibromo-4-methoxyphenyl)methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[(3,5-dibromo-4-methoxyphenyl)methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 78928832 |
| Molecular Formula | C14H19Br2NO3 |
| Molecular Weight | 409.12 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 4-[[(3,5-dibromo-4-methoxyphenyl)methylamino]methyl]oxan-4-ol |
| SMILES | COc1c(Br)cc(CNCC2(O)CCOCC2)cc1Br |
| InChI | InChI=1S/C14H19Br2NO3/c1-19-13-11(15)6-10(7-12(13)16)8-17-9-14(18)2-4-20-5-3-14/h6-7,17-18H,2-5,8-9H2,1H3 |
| InChIKey | OKZMDAJEEQFYEQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |