C14H20FNO3 — CID 78928791
4-[[(3-fluoro-4-methoxyphenyl)methylamino]methyl]oxan-4-ol (PubChem CID 78928791) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 4-[[(3-fluoro-4-methoxyphenyl)methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[(3-fluoro-4-methoxyphenyl)methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 78928791 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[[(3-fluoro-4-methoxyphenyl)methylamino]methyl]oxan-4-ol |
| SMILES | COc1ccc(CNCC2(O)CCOCC2)cc1F |
| InChI | InChI=1S/C14H20FNO3/c1-18-13-3-2-11(8-12(13)15)9-16-10-14(17)4-6-19-7-5-14/h2-3,8,16-17H,4-7,9-10H2,1H3 |
| InChIKey | KYAIVWFSXHUZET-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |