C13H19NO3 — CID 115978586
4-[[(1-hydroxycyclobutyl)methylamino]methyl]-2-methoxyphenol (PubChem CID 115978586) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[[(1-hydroxycyclobutyl)methylamino]methyl]-2-methoxyphenol.
| Compound Name | 4-[[(1-hydroxycyclobutyl)methylamino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 115978586 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-[[(1-hydroxycyclobutyl)methylamino]methyl]-2-methoxyphenol |
| SMILES | COc1cc(CNCC2(O)CCC2)ccc1O |
| InChI | InChI=1S/C13H19NO3/c1-17-12-7-10(3-4-11(12)15)8-14-9-13(16)5-2-6-13/h3-4,7,14-16H,2,5-6,8-9H2,1H3 |
| InChIKey | ZFOOAFWOFICUBI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |