C19H28N2O3 — CID 56823435
4-[5-[[(1-hydroxycyclohexyl)methylamino]methyl]-2-methoxyphenoxy]butanenitrile (PubChem CID 56823435) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 4-[5-[[(1-hydroxycyclohexyl)methylamino]methyl]-2-methoxyphenoxy]butanenitrile.
| Compound Name | 4-[5-[[(1-hydroxycyclohexyl)methylamino]methyl]-2-methoxyphenoxy]butanenitrile |
|---|---|
| PubChem CID | 56823435 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-[5-[[(1-hydroxycyclohexyl)methylamino]methyl]-2-methoxyphenoxy]butanenitrile |
| SMILES | COc1ccc(CNCC2(O)CCCCC2)cc1OCCCC#N |
| InChI | InChI=1S/C19H28N2O3/c1-23-17-8-7-16(13-18(17)24-12-6-5-11-20)14-21-15-19(22)9-3-2-4-10-19/h7-8,13,21-22H,2-6,9-10,12,14-15H2,1H3 |
| InChIKey | NVRVAVNOVQWQJD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|