C16H23F2NO3 — CID 111114413
1-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]cyclopentan-1-ol (PubChem CID 111114413) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 111114413 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]cyclopentan-1-ol |
| SMILES | CCOc1cc(CNCC2(O)CCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C16H23F2NO3/c1-2-21-14-9-12(5-6-13(14)22-15(17)18)10-19-11-16(20)7-3-4-8-16/h5-6,9,15,19-20H,2-4,7-8,10-11H2,1H3 |
| InChIKey | PQVBYLSTKOSDCG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |