C15H21F2NO2 — CID 115594079
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-(2-methylcyclopropyl)methanamine (PubChem CID 115594079) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-(2-methylcyclopropyl)methanamine.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-(2-methylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 115594079 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-(2-methylcyclopropyl)methanamine |
| SMILES | CCOc1cc(CNCC2CC2C)ccc1OC(F)F |
| InChI | InChI=1S/C15H21F2NO2/c1-3-19-14-7-11(4-5-13(14)20-15(16)17)8-18-9-12-6-10(12)2/h4-5,7,10,12,15,18H,3,6,8-9H2,1-2H3 |
| InChIKey | ZKOJAHMXMSEJCV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |