C16H23F2NO2 — CID 115690084
2-cyclobutyl-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]ethanamine (PubChem CID 115690084) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-cyclobutyl-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]ethanamine.
| Compound Name | 2-cyclobutyl-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 115690084 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-cyclobutyl-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]ethanamine |
| SMILES | CCOc1cc(CNCCC2CCC2)ccc1OC(F)F |
| InChI | InChI=1S/C16H23F2NO2/c1-2-20-15-10-13(6-7-14(15)21-16(17)18)11-19-9-8-12-4-3-5-12/h6-7,10,12,16,19H,2-5,8-9,11H2,1H3 |
| InChIKey | TYJAWJQIVGPUQV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|