C12H18N2O3 — CID 83010018
2-methoxy-4-[(morpholin-4-ylamino)methyl]phenol (PubChem CID 83010018) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-methoxy-4-[(morpholin-4-ylamino)methyl]phenol.
| Compound Name | 2-methoxy-4-[(morpholin-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 83010018 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-methoxy-4-[(morpholin-4-ylamino)methyl]phenol |
| SMILES | COc1cc(CNN2CCOCC2)ccc1O |
| InChI | InChI=1S/C12H18N2O3/c1-16-12-8-10(2-3-11(12)15)9-13-14-4-6-17-7-5-14/h2-3,8,13,15H,4-7,9H2,1H3 |
| InChIKey | VKGWBNCGUGTYMA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |