C13H18BrNO2 — CID 63360472
N-[(5-bromo-2-methoxyphenyl)methyl]oxan-3-amine (PubChem CID 63360472) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]oxan-3-amine.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 63360472 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]oxan-3-amine |
| SMILES | COc1ccc(Br)cc1CNC1CCCOC1 |
| InChI | InChI=1S/C13H18BrNO2/c1-16-13-5-4-11(14)7-10(13)8-15-12-3-2-6-17-9-12/h4-5,7,12,15H,2-3,6,8-9H2,1H3 |
| InChIKey | BSBWSKXSBDWGSU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |