C14H20BrNO3 — CID 98485911
(3S)-N-[(2-bromo-4,5-dimethoxyphenyl)methyl]oxan-3-amine (PubChem CID 98485911) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is (3S)-N-[(2-bromo-4,5-dimethoxyphenyl)methyl]oxan-3-amine.
| Compound Name | (3S)-N-[(2-bromo-4,5-dimethoxyphenyl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 98485911 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (3S)-N-[(2-bromo-4,5-dimethoxyphenyl)methyl]oxan-3-amine |
| SMILES | COc1cc(Br)c(CN[C@H]2CCCOC2)cc1OC |
| InChI | InChI=1S/C14H20BrNO3/c1-17-13-6-10(12(15)7-14(13)18-2)8-16-11-4-3-5-19-9-11/h6-7,11,16H,3-5,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | FCIVISNYLHFGLX-NSHDSACASA-N |
| XLogP | 2.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |