C14H19Br2NO2 — CID 55188959
N-[(3,5-dibromo-4-ethoxyphenyl)methyl]oxan-3-amine (PubChem CID 55188959) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-ethoxyphenyl)methyl]oxan-3-amine.
| Compound Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 55188959 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]oxan-3-amine |
| SMILES | CCOc1c(Br)cc(CNC2CCCOC2)cc1Br |
| InChI | InChI=1S/C14H19Br2NO2/c1-2-19-14-12(15)6-10(7-13(14)16)8-17-11-4-3-5-18-9-11/h6-7,11,17H,2-5,8-9H2,1H3 |
| InChIKey | XAXXTQYLYAILQG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |