C15H22Br2N2O — CID 62319975
4-N-[(3,5-dibromo-4-ethoxyphenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 62319975) has the molecular formula C15H22Br2N2O and a molecular weight of 406.16 g/mol. Its IUPAC name is 4-N-[(3,5-dibromo-4-ethoxyphenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(3,5-dibromo-4-ethoxyphenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62319975 |
| Molecular Formula | C15H22Br2N2O |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 4-N-[(3,5-dibromo-4-ethoxyphenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | CCOc1c(Br)cc(CNC2CCC(N)CC2)cc1Br |
| InChI | InChI=1S/C15H22Br2N2O/c1-2-20-15-13(16)7-10(8-14(15)17)9-19-12-5-3-11(18)4-6-12/h7-8,11-12,19H,2-6,9,18H2,1H3 |
| InChIKey | CMTVKPHOGXVSPV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |