C22H28Cl2N2O5 — CID 163326508
methyl 5-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate;hydrochloride (PubChem CID 163326508) has the molecular formula C22H28Cl2N2O5 and a molecular weight of 471.38 g/mol. Its IUPAC name is methyl 5-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate;hydrochloride.
| Compound Name | methyl 5-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 163326508 |
| Molecular Formula | C22H28Cl2N2O5 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | methyl 5-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-2-morpholin-4-ylbenzoate;hydrochloride |
| SMILES | CCOc1cc(CNc2ccc(N3CCOCC3)c(C(=O)OC)c2)cc(Cl)c1OC.Cl |
| InChI | InChI=1S/C22H27ClN2O5.ClH/c1-4-30-20-12-15(11-18(23)21(20)27-2)14-24-16-5-6-19(17(13-16)22(26)28-3)25-7-9-29-10-8-25;/h5-6,11-13,24H,4,7-10,14H2,1-3H3;1H |
| InChIKey | VKLBPDHTKZHJBG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|