C27H29Cl2N3O4 — CID 66539332
2-[2-chloro-4-[(3-chloro-4-morpholin-4-ylanilino)methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66539332) has the molecular formula C27H29Cl2N3O4 and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[2-chloro-4-[(3-chloro-4-morpholin-4-ylanilino)methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(3-chloro-4-morpholin-4-ylanilino)methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66539332 |
| Molecular Formula | C27H29Cl2N3O4 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 2-[2-chloro-4-[(3-chloro-4-morpholin-4-ylanilino)methyl]-6-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(CNc2ccc(N3CCOCC3)c(Cl)c2)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H29Cl2N3O4/c1-18-3-5-20(6-4-18)31-26(33)17-36-27-23(29)13-19(14-25(27)34-2)16-30-21-7-8-24(22(28)15-21)32-9-11-35-12-10-32/h3-8,13-15,30H,9-12,16-17H2,1-2H3,(H,31,33) |
| InChIKey | AZMKFOQBZCTYNQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|