C24H32ClN3O3 — CID 112839502
2-(azepan-1-yl)-N-[4-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]phenyl]acetamide (PubChem CID 112839502) has the molecular formula C24H32ClN3O3 and a molecular weight of 445.99 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[4-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]phenyl]acetamide.
| Compound Name | 2-(azepan-1-yl)-N-[4-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 112839502 |
| Molecular Formula | C24H32ClN3O3 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-(azepan-1-yl)-N-[4-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]phenyl]acetamide |
| SMILES | CCOc1c(Cl)cc(CNc2ccc(NC(=O)CN3CCCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C24H32ClN3O3/c1-3-31-24-21(25)14-18(15-22(24)30-2)16-26-19-8-10-20(11-9-19)27-23(29)17-28-12-6-4-5-7-13-28/h8-11,14-15,26H,3-7,12-13,16-17H2,1-2H3,(H,27,29) |
| InChIKey | WWLUSQJVXNVCMM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |