C24H23Cl3N2O4 — CID 66539432
2-[2-chloro-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66539432) has the molecular formula C24H23Cl3N2O4 and a molecular weight of 509.82 g/mol. Its IUPAC name is 2-[2-chloro-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66539432 |
| Molecular Formula | C24H23Cl3N2O4 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 2-[2-chloro-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(CNc2cc(Cl)c(O)c(Cl)c2)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H23Cl3N2O4/c1-3-32-21-9-15(12-28-17-10-18(25)23(31)19(26)11-17)8-20(27)24(21)33-13-22(30)29-16-6-4-14(2)5-7-16/h4-11,28,31H,3,12-13H2,1-2H3,(H,29,30) |
| InChIKey | BMSVUNGOCPJNFP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|