C24H26ClN3O5S — CID 66539433
2-[2-chloro-6-ethoxy-4-[(4-sulfamoylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66539433) has the molecular formula C24H26ClN3O5S and a molecular weight of 504.01 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(4-sulfamoylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(4-sulfamoylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66539433 |
| Molecular Formula | C24H26ClN3O5S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(4-sulfamoylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(CNc2ccc(S(N)(=O)=O)cc2)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H26ClN3O5S/c1-3-32-22-13-17(14-27-18-8-10-20(11-9-18)34(26,30)31)12-21(25)24(22)33-15-23(29)28-19-6-4-16(2)5-7-19/h4-13,27H,3,14-15H2,1-2H3,(H,28,29)(H2,26,30,31) |
| InChIKey | UOKQBARFTBXQEA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |