C22H25ClN6O3 — CID 66539378
2-[2-chloro-6-ethoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66539378) has the molecular formula C22H25ClN6O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66539378 |
| Molecular Formula | C22H25ClN6O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[(1-prop-2-enyltetrazol-5-yl)amino]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | C=CCn1nnnc1NCc1cc(Cl)c(OCC(=O)Nc2ccc(C)cc2)c(OCC)c1 |
| InChI | InChI=1S/C22H25ClN6O3/c1-4-10-29-22(26-27-28-29)24-13-16-11-18(23)21(19(12-16)31-5-2)32-14-20(30)25-17-8-6-15(3)7-9-17/h4,6-9,11-12H,1,5,10,13-14H2,2-3H3,(H,25,30)(H,24,26,28) |
| InChIKey | JXPRINKKUQAPOZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|