C18H20ClNO5 — CID 17059633
3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-4-methoxybenzoic acid (PubChem CID 17059633) has the molecular formula C18H20ClNO5 and a molecular weight of 365.81 g/mol. Its IUPAC name is 3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 17059633 |
| Molecular Formula | C18H20ClNO5 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-4-methoxybenzoic acid |
| SMILES | CCOc1c(Cl)cc(CNc2cc(C(=O)O)ccc2OC)cc1OC |
| InChI | InChI=1S/C18H20ClNO5/c1-4-25-17-13(19)7-11(8-16(17)24-3)10-20-14-9-12(18(21)22)5-6-15(14)23-2/h5-9,20H,4,10H2,1-3H3,(H,21,22) |
| InChIKey | SHKCPHSTKBIRCU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |