C24H24ClN3O4 — CID 55949411
N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide (PubChem CID 55949411) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 55949411 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-4-(phenylcarbamoylamino)benzamide |
| SMILES | CCOc1c(Cl)cc(CNC(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H24ClN3O4/c1-3-32-22-20(25)13-16(14-21(22)31-2)15-26-23(29)17-9-11-19(12-10-17)28-24(30)27-18-7-5-4-6-8-18/h4-14H,3,15H2,1-2H3,(H,26,29)(H2,27,28,30) |
| InChIKey | DLFIGASFMWXYDR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |