C18H20ClNO5S — CID 47063310
N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-methylsulfonylbenzamide (PubChem CID 47063310) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 47063310 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-methylsulfonylbenzamide |
| SMILES | CCOc1c(Cl)cc(CNC(=O)c2cccc(S(C)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C18H20ClNO5S/c1-4-25-17-15(19)8-12(9-16(17)24-2)11-20-18(21)13-6-5-7-14(10-13)26(3,22)23/h5-10H,4,11H2,1-3H3,(H,20,21) |
| InChIKey | CMLHPJAOLMAEOM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |