C18H20N2O7S — CID 31301682
3,4,5-trimethoxy-N'-(3-methylsulfonylbenzoyl)benzohydrazide (PubChem CID 31301682) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-(3-methylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-(3-methylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 31301682 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3,4,5-trimethoxy-N'-(3-methylsulfonylbenzoyl)benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccc(S(C)(=O)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H20N2O7S/c1-25-14-9-12(10-15(26-2)16(14)27-3)18(22)20-19-17(21)11-6-5-7-13(8-11)28(4,23)24/h5-10H,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | QGIZSCLALGXJCB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|