C21H26Cl2N2O5 — CID 166185875
1,3-bis[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]urea (PubChem CID 166185875) has the molecular formula C21H26Cl2N2O5 and a molecular weight of 457.35 g/mol. Its IUPAC name is 1,3-bis[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]urea.
| Compound Name | 1,3-bis[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 166185875 |
| Molecular Formula | C21H26Cl2N2O5 |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1,3-bis[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]urea |
| SMILES | CCOc1c(Cl)cc(CNC(=O)NCc2cc(Cl)c(OCC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H26Cl2N2O5/c1-5-29-19-15(22)7-13(9-17(19)27-3)11-24-21(26)25-12-14-8-16(23)20(30-6-2)18(10-14)28-4/h7-10H,5-6,11-12H2,1-4H3,(H2,24,25,26) |
| InChIKey | MWWISBJECLZNEA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |