C17H16Cl2INO3 — CID 55892518
5-chloro-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-iodobenzamide (PubChem CID 55892518) has the molecular formula C17H16Cl2INO3 and a molecular weight of 480.13 g/mol. Its IUPAC name is 5-chloro-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-iodobenzamide.
| Compound Name | 5-chloro-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 55892518 |
| Molecular Formula | C17H16Cl2INO3 |
| Molecular Weight | 480.13 g/mol |
| Exact Mass | 478.96 |
| IUPAC Name | 5-chloro-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-iodobenzamide |
| SMILES | CCOc1c(Cl)cc(CNC(=O)c2cc(Cl)ccc2I)cc1OC |
| InChI | InChI=1S/C17H16Cl2INO3/c1-3-24-16-13(19)6-10(7-15(16)23-2)9-21-17(22)12-8-11(18)4-5-14(12)20/h4-8H,3,9H2,1-2H3,(H,21,22) |
| InChIKey | GATRKDFWMJMIID-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.13 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|