C13H20Cl2N2O3 — CID 119293696
3-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]propanamide;hydrochloride (PubChem CID 119293696) has the molecular formula C13H20Cl2N2O3 and a molecular weight of 323.22 g/mol. Its IUPAC name is 3-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]propanamide;hydrochloride.
| Compound Name | 3-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119293696 |
| Molecular Formula | C13H20Cl2N2O3 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]propanamide;hydrochloride |
| SMILES | CCOc1c(Cl)cc(CNC(=O)CCN)cc1OC.Cl |
| InChI | InChI=1S/C13H19ClN2O3.ClH/c1-3-19-13-10(14)6-9(7-11(13)18-2)8-16-12(17)4-5-15;/h6-7H,3-5,8,15H2,1-2H3,(H,16,17);1H |
| InChIKey | PYZCLZAHCWCJNX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |