C16H26Cl2N2O3 — CID 119731450
2-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylpentanamide;hydrochloride (PubChem CID 119731450) has the molecular formula C16H26Cl2N2O3 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119731450 |
| Molecular Formula | C16H26Cl2N2O3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-amino-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NCc1cc(Cl)c(OCC)c(OC)c1.Cl |
| InChI | InChI=1S/C16H25ClN2O3.ClH/c1-5-7-16(3,18)15(20)19-10-11-8-12(17)14(22-6-2)13(9-11)21-4;/h8-9H,5-7,10,18H2,1-4H3,(H,19,20);1H |
| InChIKey | MDAVWQUQPSNJJU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |