C19H30ClIN4O4 — CID 111164506
ethyl 4-[N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164506) has the molecular formula C19H30ClIN4O4 and a molecular weight of 540.83 g/mol. Its IUPAC name is ethyl 4-[N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164506 |
| Molecular Formula | C19H30ClIN4O4 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | ethyl 4-[N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N\C)NCc2cc(Cl)c(OCC)c(OC)c2)CC1.I |
| InChI | InChI=1S/C19H29ClN4O4.HI/c1-5-27-17-15(20)11-14(12-16(17)26-4)13-22-18(21-3)23-7-9-24(10-8-23)19(25)28-6-2;/h11-12H,5-10,13H2,1-4H3,(H,21,22);1H |
| InChIKey | WYLVVHPHCUKGME-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|