C20H29ClIN5O2 — CID 111742980
N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111742980) has the molecular formula C20H29ClIN5O2 and a molecular weight of 533.84 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111742980 |
| Molecular Formula | C20H29ClIN5O2 |
| Molecular Weight | 533.84 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1c(Cl)cc(CN/C(=N/C)N2CCC(c3cnn(C)c3)C2)cc1OC.I |
| InChI | InChI=1S/C20H28ClN5O2.HI/c1-5-28-19-17(21)8-14(9-18(19)27-4)10-23-20(22-2)26-7-6-15(13-26)16-11-24-25(3)12-16;/h8-9,11-12,15H,5-7,10,13H2,1-4H3,(H,22,23);1H |
| InChIKey | IJFSUJABJFWGFL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|