C23H33IN4O3 — CID 110961082
N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110961082) has the molecular formula C23H33IN4O3 and a molecular weight of 540.45 g/mol. Its IUPAC name is N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110961082 |
| Molecular Formula | C23H33IN4O3 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)N2CCN(c3ccccc3)CC2)cc1OC.I |
| InChI | InChI=1S/C23H32N4O3.HI/c1-5-30-22-20(28-3)15-18(16-21(22)29-4)17-25-23(24-2)27-13-11-26(12-14-27)19-9-7-6-8-10-19;/h6-10,15-16H,5,11-14,17H2,1-4H3,(H,24,25);1H |
| InChIKey | FJTSSPVMEBCEJU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|