C21H28N4O3 — CID 110961031
N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide (PubChem CID 110961031) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961031 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cc(OC)c(O)c(OC)c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-22-21(23-15-16-13-18(27-2)20(26)19(14-16)28-3)25-11-9-24(10-12-25)17-7-5-4-6-8-17/h4-8,13-14,26H,9-12,15H2,1-3H3,(H,22,23) |
| InChIKey | MNAYYUZRDIJDJC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|