C24H34N4O3 — CID 110959763
4-benzyl-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 110959763) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-benzyl-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110959763 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 4-benzyl-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)N2CCN(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C24H34N4O3/c1-5-31-23-21(29-3)15-20(16-22(23)30-4)17-26-24(25-2)28-13-11-27(12-14-28)18-19-9-7-6-8-10-19/h6-10,15-16H,5,11-14,17-18H2,1-4H3,(H,25,26) |
| InChIKey | DMVNWADUXAWSOO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|