C22H31IN4O — CID 110959550
4-benzyl-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110959550) has the molecular formula C22H31IN4O and a molecular weight of 494.42 g/mol. Its IUPAC name is 4-benzyl-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110959550 |
| Molecular Formula | C22H31IN4O |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 4-benzyl-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(COC)cc1)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H30N4O.HI/c1-23-22(24-16-19-8-10-21(11-9-19)18-27-2)26-14-12-25(13-15-26)17-20-6-4-3-5-7-20;/h3-11H,12-18H2,1-2H3,(H,23,24);1H |
| InChIKey | WSMPWQUDWPHDMZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|