C26H39IN6 — CID 110960926
N'-methyl-N-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110960926) has the molecular formula C26H39IN6 and a molecular weight of 562.54 g/mol. Its IUPAC name is N'-methyl-N-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110960926 |
| Molecular Formula | C26H39IN6 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | N'-methyl-N-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CN2CCCN(C)CC2)cc1)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C26H38N6.HI/c1-27-26(32-19-17-31(18-20-32)25-7-4-3-5-8-25)28-21-23-9-11-24(12-10-23)22-30-14-6-13-29(2)15-16-30;/h3-5,7-12H,6,13-22H2,1-2H3,(H,27,28);1H |
| InChIKey | KHDSYCKMSQFULS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|