C26H27ClN2O4 — CID 55891488
N-[3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 55891488) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 55891488 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[3-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | CCOc1c(Cl)cc(CNC(=O)CC(NC(=O)c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H27ClN2O4/c1-3-33-25-21(27)14-18(15-23(25)32-2)17-28-24(30)16-22(19-10-6-4-7-11-19)29-26(31)20-12-8-5-9-13-20/h4-15,22H,3,16-17H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | LYWWJAOCYOTTCU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |