C19H25Cl2NO3 — CID 2979607
2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride (PubChem CID 2979607) has the molecular formula C19H25Cl2NO3 and a molecular weight of 386.32 g/mol. Its IUPAC name is 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride.
| Compound Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 2979607 |
| Molecular Formula | C19H25Cl2NO3 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylamino]-1-phenylpropan-1-ol;hydrochloride |
| SMILES | CCOc1c(Cl)cc(CNC(C)C(O)c2ccccc2)cc1OC.Cl |
| InChI | InChI=1S/C19H24ClNO3.ClH/c1-4-24-19-16(20)10-14(11-17(19)23-3)12-21-13(2)18(22)15-8-6-5-7-9-15;/h5-11,13,18,21-22H,4,12H2,1-3H3;1H |
| InChIKey | HSUQFMXEUXMYST-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |