C25H28BrNO3 — CID 17054532
2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylpropan-1-ol (PubChem CID 17054532) has the molecular formula C25H28BrNO3 and a molecular weight of 470.41 g/mol. Its IUPAC name is 2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylpropan-1-ol.
| Compound Name | 2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 17054532 |
| Molecular Formula | C25H28BrNO3 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-1-phenylpropan-1-ol |
| SMILES | COc1cc(CNC(C)C(O)c2ccccc2)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H28BrNO3/c1-17-9-11-19(12-10-17)16-30-25-22(26)13-20(14-23(25)29-3)15-27-18(2)24(28)21-7-5-4-6-8-21/h4-14,18,24,27-28H,15-16H2,1-3H3 |
| InChIKey | UCGABOOUXZIWRM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |