C19H24ClNO2 — CID 126127441
N-[(3-chloro-4,5-diethoxyphenyl)methyl]-4-ethylaniline (PubChem CID 126127441) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is N-[(3-chloro-4,5-diethoxyphenyl)methyl]-4-ethylaniline.
| Compound Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-4-ethylaniline |
|---|---|
| PubChem CID | 126127441 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[(3-chloro-4,5-diethoxyphenyl)methyl]-4-ethylaniline |
| SMILES | CCOc1cc(CNc2ccc(CC)cc2)cc(Cl)c1OCC |
| InChI | InChI=1S/C19H24ClNO2/c1-4-14-7-9-16(10-8-14)21-13-15-11-17(20)19(23-6-3)18(12-15)22-5-2/h7-12,21H,4-6,13H2,1-3H3 |
| InChIKey | WGPRACDRUYEATI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |