C23H23BrClNO2 — CID 126120752
N-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methyl]-4-methylaniline (PubChem CID 126120752) has the molecular formula C23H23BrClNO2 and a molecular weight of 460.80 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methyl]-4-methylaniline.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methyl]-4-methylaniline |
|---|---|
| PubChem CID | 126120752 |
| Molecular Formula | C23H23BrClNO2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methyl]-4-methylaniline |
| SMILES | CCOc1cc(CNc2ccc(C)cc2)cc(Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H23BrClNO2/c1-3-27-22-13-18(14-26-20-10-4-16(2)5-11-20)12-21(25)23(22)28-15-17-6-8-19(24)9-7-17/h4-13,26H,3,14-15H2,1-2H3 |
| InChIKey | JOIGRFQVIJVDPB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |