C21H28ClNO2 — CID 17055417
N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 17055417) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 17055417 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCOc1cc(CNC(C)(C)C)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C21H28ClNO2/c1-6-24-19-12-17(13-23-21(3,4)5)11-18(22)20(19)25-14-16-9-7-15(2)8-10-16/h7-12,23H,6,13-14H2,1-5H3 |
| InChIKey | XBYQJPPZHYWFQE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |