C25H28INO2 — CID 126124383
N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]-4-ethylaniline (PubChem CID 126124383) has the molecular formula C25H28INO2 and a molecular weight of 501.41 g/mol. Its IUPAC name is N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]-4-ethylaniline.
| Compound Name | N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]-4-ethylaniline |
|---|---|
| PubChem CID | 126124383 |
| Molecular Formula | C25H28INO2 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]-4-ethylaniline |
| SMILES | CCOc1cc(CNc2ccc(CC)cc2)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H28INO2/c1-4-19-10-12-22(13-11-19)27-16-21-14-23(26)25(24(15-21)28-5-2)29-17-20-8-6-18(3)7-9-20/h6-15,27H,4-5,16-17H2,1-3H3 |
| InChIKey | MWEWFNPHJLIJCM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|