C23H24INO2 — CID 126127038
N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline (PubChem CID 126127038) has the molecular formula C23H24INO2 and a molecular weight of 473.35 g/mol. Its IUPAC name is N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline.
| Compound Name | N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 126127038 |
| Molecular Formula | C23H24INO2 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | N-[[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methyl]aniline |
| SMILES | CCOc1cc(CNc2ccccc2)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H24INO2/c1-3-26-22-14-19(15-25-20-7-5-4-6-8-20)13-21(24)23(22)27-16-18-11-9-17(2)10-12-18/h4-14,25H,3,15-16H2,1-2H3 |
| InChIKey | SFNKYWLWUVGCGL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|