C27H30N2O5 — CID 4727956
5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-morpholin-4-ylbenzoic acid (PubChem CID 4727956) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-morpholin-4-ylbenzoic acid.
| Compound Name | 5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 4727956 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]-2-morpholin-4-ylbenzoic acid |
| SMILES | COc1cc(CNc2ccc(N3CCOCC3)c(C(=O)O)c2)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C27H30N2O5/c1-19-3-5-20(6-4-19)18-34-25-10-7-21(15-26(25)32-2)17-28-22-8-9-24(23(16-22)27(30)31)29-11-13-33-14-12-29/h3-10,15-16,28H,11-14,17-18H2,1-2H3,(H,30,31) |
| InChIKey | GBJCYFVXRYTCJQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|