C19H21N2O3- — CID 7325755
5-[(4-methylphenyl)methylamino]-2-morpholin-4-ylbenzoate (PubChem CID 7325755) has the molecular formula C19H21N2O3- and a molecular weight of 325.39 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methylamino]-2-morpholin-4-ylbenzoate.
| Compound Name | 5-[(4-methylphenyl)methylamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 7325755 |
| Molecular Formula | C19H21N2O3- |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 5-[(4-methylphenyl)methylamino]-2-morpholin-4-ylbenzoate |
| SMILES | Cc1ccc(CNc2ccc(N3CCOCC3)c(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-14-2-4-15(5-3-14)13-20-16-6-7-18(17(12-16)19(22)23)21-8-10-24-11-9-21/h2-7,12,20H,8-11,13H2,1H3,(H,22,23)/p-1 |
| InChIKey | OABJWSLRBDBUOK-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|